Difference between revisions of "NTDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11917 RXN-11917] == * direction: ** LEFT-TO-RIGHT * common name: ** 7-methyl-3-oxo-6-octenoyl-C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11917 RXN-11917] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3- | + | ** 7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] |
* Synonym(s): | * Synonym(s): | ||
| − | ** 3- | + | ** 7-methyl-3-oxo-6-octenoyl-CoA thiolase |
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[CO-A]][c] '''+''' 1 [[CPD-12897]][c] '''=>''' 1 [[CPD-12902]][c] '''+''' 1 [[ACETYL-COA]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 coenzyme A[c] '''+''' 1 7-methyl-3-oxooct-6-enoyl-CoA[c] '''=>''' 1 5-methylhex-4-enoyl-CoA[c] '''+''' 1 acetyl-CoA[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_16181]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672] | ||
| + | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08091 R08091] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase}} |
| − | {{#set: common name=3- | + | {{#set: ec number=EC-2.3.1}} |
| − | {{#set: | + | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA thiolase}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_16181}} |
| − | {{#set: | + | {{#set: in pathway=PWY-6672}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 00:13, 19 March 2018
Contents
Reaction RXN-11917
- direction:
- LEFT-TO-RIGHT
- common name:
- 7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase
- ec number:
- Synonym(s):
- 7-methyl-3-oxo-6-octenoyl-CoA thiolase
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 CPD-12897[c] => 1 CPD-12902[c] + 1 ACETYL-COA[c]
- With common name(s):
- 1 coenzyme A[c] + 1 7-methyl-3-oxooct-6-enoyl-CoA[c] => 1 5-methylhex-4-enoyl-CoA[c] + 1 acetyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6672, cis-genanyl-CoA degradation: PWY-6672
- 4 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links
- LIGAND-RXN:
