Difference between revisions of "CPD-5170"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IDS2 IDS2] == * direction: ** LEFT-TO-RIGHT * common name: ** dimethylallyl-diphosphate synthase *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IDS2 IDS2] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dimethylallyl-diphosphate synthase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''+''' 1.0 [[HYDROXY-METHYL-BUTENYL-DIP]][h] '''=>''' 1.0 [[CPD-4211]][h] '''+''' 1.0 [[WATER]][h] '''+''' 1.0 [[NADP]][h] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 H+[h] '''+''' 1.0 NADPH[h] '''+''' 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h] '''=>''' 1.0 dimethylallyl diphosphate[h] '''+''' 1.0 H2O[h] '''+''' 1.0 NADP+[h] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_5609]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=dimethylallyl-diphosphate synthase}} | |
| − | + | {{#set: gene associated=Tiso_gene_5609}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 00:14, 19 March 2018
Contents
Reaction IDS2
- direction:
- LEFT-TO-RIGHT
- common name:
- dimethylallyl-diphosphate synthase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 H+[h] + 1.0 NADPH[h] + 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h] => 1.0 dimethylallyl diphosphate[h] + 1.0 H2O[h] + 1.0 NADP+[h]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
