Difference between revisions of "1-O-SINAPOYL-BETA-D-GLUCOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * smiles: ** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=orDC orDC] == * direction: ** LEFT-TO-RIGHT * common name: ** ornithine decarboxylase * Synonym(s):...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=orDC orDC] ==
−
* smiles:
+
* direction:
−
** C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M
+
 
* common name:
 
* common name:
−
** hypoglycin B
+
** ornithine decarboxylase
−
* molecular weight:
+
−
** 269.277   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine B
 
−
** L-gamma-glutamyl-L-hypoglycin
 
−
** γ-glutamyl-β-(methylenecyclopropyl)-alanine
 
−
** (2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-9157]]
+
** 1.0 [[L-ORNITHINE]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 1.0 [[PUTRESCINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 L-ornithine[c] '''+''' 1.0 H+[c] '''=>''' 1.0 CO2[c] '''+''' 1.0 putrescine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10737]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658135 90658135]
+
{{#set: common name=ornithine decarboxylase}}
−
* Wikipedia : Hypoglycin_B
+
{{#set: gene associated=Tiso_gene_10737}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08280 C08280]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB29428
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C=C1(C(CC(C(=O)[O-])NC(CCC([N+])C([O-])=O)=O)C1)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=UYDZYCPIQSRXKU-NPPUSCPJSA-M}}
+
−
{{#set: common name=hypoglycin B}}
+
−
{{#set: molecular weight=269.277    }}
+
−
{{#set: common name=hypoglycine B|L-gamma-glutamyl-L-hypoglycin|γ-glutamyl-β-(methylenecyclopropyl)-alanine|(2S)-2-amino-5-[[(2S)-1-hydroxy-3-[(1S)-2-methylidenecyclopropyl]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid}}
+
−
{{#set: produced by=RXN-9157}}
+

Revision as of 00:15, 19 March 2018

Reaction orDC

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ornithine decarboxylase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1-O-SINAPOYL-BETA-D-GLUCOSE&oldid=29413"