Difference between revisions of "RXN-5962"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...")
(Created page with "Category:Gene == Gene Tiso_gene_2447 == * left end position: ** 8 * transcription direction: ** POSITIVE * right end position: ** 4580 * centisome position: ** 4.122648800...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
+
== Gene Tiso_gene_2447 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 8
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** gibberellin A1
+
** 4580
−
* molecular weight:
+
* centisome position:
−
** 347.387   
+
** 4.122648800e-2
 
* Synonym(s):
 
* Synonym(s):
−
** GA1
 
−
** gibberellin 1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-115]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=8}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4580}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717]
+
{{#set: centisome position=4.122648800e-2}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}}
+
−
{{#set: common name=gibberellin A1}}
+
−
{{#set: molecular weight=347.387    }}
+
−
{{#set: common name=GA1|gibberellin 1}}
+
−
{{#set: consumed by=RXN-115}}
+

Revision as of 01:15, 19 March 2018

Gene Tiso_gene_2447

  • left end position:
    • 8
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4580
  • centisome position:
    • 4.122648800e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-5962&oldid=29437"