Difference between revisions of "CPD-702"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...") |
(Created page with "Category:Gene == Gene Tiso_gene_11923 == * left end position: ** 28 * transcription direction: ** NEGATIVE * right end position: ** 4803 * centisome position: ** 0.3775111...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_11923 == |
| − | * | + | * left end position: |
| − | ** | + | ** 28 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 4803 |
| − | * | + | * centisome position: |
| − | ** | + | ** 0.3775111 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[ATPASE-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=28}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=4803}} | |
| − | + | {{#set: centisome position=0.3775111 }} | |
| − | + | {{#set: reaction associated=ATPASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 00:16, 19 March 2018
Gene Tiso_gene_11923
- left end position:
- 28
- transcription direction:
- NEGATIVE
- right end position:
- 4803
- centisome position:
- 0.3775111
- Synonym(s):
Reactions associated
- ATPASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
