Difference between revisions of "RXN1G-364"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTPH UTPH] == * direction: ** LEFT-TO-RIGHT * common name: ** UTP phosphohydrolase * Synonym(s): =...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UTPH UTPH] ==
−
* smiles:
+
* direction:
−
** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
+
 
* common name:
 
* common name:
−
** 3-hydroxyisovaleryl-CoA
+
** UTP phosphohydrolase
−
* molecular weight:
+
−
** 863.619   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-isovaleryl-coa
 
−
** 3-hydroxy-iso-valeryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[UTP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[UDP]][c] '''+''' 1.0 [[PROTON]][c]
−
* [[RXN-14266]]
+
* With common name(s):
 +
** 1.0 UTP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 UDP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12899]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667]
+
{{#set: common name=UTP phosphohydrolase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12899}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=3-hydroxyisovaleryl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=863.619    }}
+
−
{{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}}
+
−
{{#set: consumed or produced by=RXN-14266}}
+

Revision as of 00:16, 19 March 2018

Reaction UTPH

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UTP phosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 UTP[c] + 1.0 H2O[c] => 1.0 phosphate[c] + 1.0 UDP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-364&oldid=29509"