Difference between revisions of "Tiso gene 13355"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...") |
(Created page with "Category:Gene == Gene Tiso_gene_1163 == * left end position: ** 12300 * transcription direction: ** POSITIVE * right end position: ** 14054 * centisome position: ** 48.240...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1163 == |
− | * | + | * left end position: |
− | ** | + | ** 12300 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 14054 |
− | * | + | * centisome position: |
− | ** | + | ** 48.240967 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[DIACYLGLYKIN-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | * [[NAD-KIN-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN3DJ-11417]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[SPHINGANINE-KINASE-RXN]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY3DJ-11470]] | ||
+ | * [[PWY-7268]] | ||
+ | * [[PWY-7269]] | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-5129]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY-1]] | ||
+ | * [[PWY-7119]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=12300}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=14054}} | |
− | + | {{#set: centisome position=48.240967 }} | |
− | + | {{#set: reaction associated=DIACYLGLYKIN-RXN|NAD-KIN-RXN|RXN3DJ-11417|SPHINGANINE-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY3DJ-11470|PWY-7268|PWY-7269|PWY-7817|PWY-5129|PWY-5083|NADPHOS-DEPHOS-PWY-1|PWY-7119|PWY-7039|NADPHOS-DEPHOS-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:16, 19 March 2018
Gene Tiso_gene_1163
- left end position:
- 12300
- transcription direction:
- POSITIVE
- right end position:
- 14054
- centisome position:
- 48.240967
- Synonym(s):
Reactions associated
- DIACYLGLYKIN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- NAD-KIN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN3DJ-11417
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- SPHINGANINE-KINASE-RXN
Pathways associated
- PWY3DJ-11470
- PWY-7268
- PWY-7269
- PWY-7817
- PWY-5129
- PWY-5083
- NADPHOS-DEPHOS-PWY-1
- PWY-7119
- PWY-7039
- NADPHOS-DEPHOS-PWY