Difference between revisions of "2-Hydroxy-Fatty-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_8387 == * left end position: ** 383 * transcription direction: ** POSITIVE * right end position: ** 2571 * centisome position: ** 3.719169...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8387 == |
− | * | + | * left end position: |
− | ** | + | ** 383 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2571 |
− | * | + | * centisome position: |
− | ** | + | ** 3.719169 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.4.1.142-RXN]] |
− | * | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] |
== External links == | == External links == | ||
− | + | {{#set: left end position=383}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2571}} | |
− | + | {{#set: centisome position=3.719169 }} | |
− | + | {{#set: reaction associated=2.4.1.142-RXN}} | |
− | + | {{#set: pathway associated=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 00:17, 19 March 2018
Gene Tiso_gene_8387
- left end position:
- 383
- transcription direction:
- POSITIVE
- right end position:
- 2571
- centisome position:
- 3.719169
- Synonym(s):
Reactions associated
- 2.4.1.142-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation