Difference between revisions of "RXN-13313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6274 RXN0-6274] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6274 RXN0-6274] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.75 EC-2.5.1.75] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[tRNA-Adenosines-37]][c] '''+''' 1 [[CPD-4211]][c] '''=>''' 1 [[6-Dimethylallyladenosine37-tRNAs]][c] '''+''' 1 [[PPI]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an adenosine37 in tRNA[c] '''+''' 1 dimethylallyl diphosphate[c] '''=>''' 1 N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 diphosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_3274]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-2781]], cis-zeatin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2781 PWY-2781] | ||
| + | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01122 R01122] |
| − | {{#set: | + | * UNIPROT: |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9ZUX7 Q9ZUX7] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P46811 P46811] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07884 P07884] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JUU5 Q9JUU5] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A3Q6 P0A3Q6] |
| + | {{#set: direction=LEFT-TO-RIGHT}} | ||
| + | {{#set: ec number=EC-2.5.1.75}} | ||
| + | {{#set: gene associated=Tiso_gene_3274}} | ||
| + | {{#set: in pathway=PWY-2781}} | ||
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction source=orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 00:17, 19 March 2018
Contents
Reaction RXN0-6274
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 tRNA-Adenosines-37[c] + 1 CPD-4211[c] => 1 6-Dimethylallyladenosine37-tRNAs[c] + 1 PPI[c]
- With common name(s):
- 1 an adenosine37 in tRNA[c] + 1 dimethylallyl diphosphate[c] => 1 N6-dimethylallyladenosine37 in tRNA[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
