Difference between revisions of "DEPHOSPHOCOAKIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4174 RXNQT-4174] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydro...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4174 RXNQT-4174] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
+
** 3-isopropylmalate dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 611.959   
+
** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5284]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPDQT-39]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-30]][c] '''+''' 1 [[NADH]][c]
−
* [[RXN-5283]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 3-(6'-methylthio)hexylmalate[c] '''=>''' 1 CO2[c] '''+''' 1 9-(methylthio)-2-oxononanoate[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2920]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08642 R08642]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490]
+
{{#set: common name=3-isopropylmalate dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.85}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830]
+
{{#set: gene associated=Tiso_gene_2920}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: in pathway=}}
−
{{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=611.959    }}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
{{#set: consumed by=RXN-5284}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN-5283}}
+

Revision as of 00:17, 19 March 2018

Reaction RXNQT-4174

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-isopropylmalate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 3-(6'-methylthio)hexylmalate[c] => 1 CO2[c] + 1 9-(methylthio)-2-oxononanoate[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DEPHOSPHOCOAKIN-RXN&oldid=29607"