Difference between revisions of "PWY-6363"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] == * smiles: ** C(S(=O)(=O)[O-])C[N+] * inchi key: ** InChIKey=XOAAWQZATWQOTB-...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] ==
* smiles:
+
* taxonomic range:
** C(S(=O)(=O)[O-])C[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
* inchi key:
+
** InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** taurine
+
** nitrate reduction VI (assimilatory)
* molecular weight:
+
** 125.142   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-aminoethanesulfonate
+
** nitrate assimilation
** tauphon
+
** taufon
+
** 2-aminoethanesulfonic acid
+
** aminoetylsulphonic acid
+
** ethylaminesulphonic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-299]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_7919]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_14842]]
 +
*** [[Tiso_gene_13754]]
 +
*** [[Tiso_gene_13820]]
 +
*** [[Tiso_gene_6647]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[GLUTDEHYD-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_2581]]
 +
*** [[Tiso_gene_1154]]
 +
*** [[Tiso_gene_11511]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.7.7.2-RXN 1.7.7.2-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 107-35-7
+
{{#set: taxonomic range=TAX-1117}}
* METABOLIGHTS : MTBLC507393
+
{{#set: common name=nitrate reduction VI (assimilatory)}}
* PUBCHEM:
+
{{#set: common name=nitrate assimilation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4068592 4068592]
+
{{#set: reaction found=3}}
* HMDB : HMDB00251
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=75.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00245 C00245]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=507393 507393]
+
* BIGG : taur
+
{{#set: smiles=C(S(=O)(=O)[O-])C[N+]}}
+
{{#set: inchi key=InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N}}
+
{{#set: common name=taurine}}
+
{{#set: molecular weight=125.142    }}
+
{{#set: common name=2-aminoethanesulfonate|tauphon|taufon|2-aminoethanesulfonic acid|aminoetylsulphonic acid|ethylaminesulphonic acid}}
+
{{#set: consumed by=RXN0-299}}
+

Revision as of 14:44, 21 March 2018

Pathway PWY490-3

  • taxonomic range:
  • common name:
    • nitrate reduction VI (assimilatory)
  • Synonym(s):
    • nitrate assimilation

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links