Difference between revisions of "Tiso gene 5765"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNAs mRNAs] == * common name: ** an mRNA * Synonym(s): == Reaction(s) known to consume the co...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNAs mRNAs] ==
* smiles:
+
** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
+
* inchi key:
+
** InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
+
 
* common name:
 
* common name:
** N-acetyl-serotonin glucuronide
+
** an mRNA
* molecular weight:
+
** 393.372   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-5-hydroxytryptamine glucuronide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
+
* [[3.1.13.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an mRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29971053 29971053]
+
{{#set: produced by=3.1.13.4-RXN}}
{{#set: smiles=CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))}}
+
{{#set: reversible reaction associated=POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN}}
{{#set: inchi key=InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M}}
+
{{#set: common name=N-acetyl-serotonin glucuronide}}
+
{{#set: molecular weight=393.372    }}
+
{{#set: common name=N-acetyl-5-hydroxytryptamine glucuronide}}
+
{{#set: produced by=RXN-11060}}
+

Revision as of 14:45, 21 March 2018

Metabolite mRNAs

  • common name:
    • an mRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links