Difference between revisions of "7-METHYLXANTHINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5241 == * left end position: ** 8515 * transcription direction: ** POSITIVE * right end position: ** 11142 * centisome position: ** 62.0129...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == |
− | * | + | * smiles: |
− | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) |
− | * | + | * common name: |
− | ** | + | ** (2R,3S,4S)-leucocyanidin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 306.271 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,3-trans-3,4-cis-leucocyanidin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-602]] |
− | + | * [[1.14.11.19-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-600]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440833 440833] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389677.html 389677] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11412 11412] | ||
+ | * METABOLIGHTS : MTBLC11412 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05906 C05906] | ||
+ | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)}} | ||
+ | {{#set: common name=(2R,3S,4S)-leucocyanidin}} | ||
+ | {{#set: inchi key=InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N}} | ||
+ | {{#set: molecular weight=306.271 }} | ||
+ | {{#set: common name=2,3-trans-3,4-cis-leucocyanidin}} | ||
+ | {{#set: consumed by=RXN-602|1.14.11.19-RXN}} | ||
+ | {{#set: produced by=RXN-600}} |
Revision as of 14:45, 21 March 2018
Contents
Metabolite CPD-590
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O)
- common name:
- (2R,3S,4S)-leucocyanidin
- inchi key:
- InChIKey=SBZWTSHAFILOTE-SOUVJXGZSA-N
- molecular weight:
- 306.271
- Synonym(s):
- 2,3-trans-3,4-cis-leucocyanidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links