Difference between revisions of "Tiso gene 3211"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * smiles: ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Gene == Gene Tiso_gene_12256 == * right end position: ** 7189 * transcription direction: ** NEGATIVE * left end position: ** 3060 * centisome position: ** 42.5591...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+
== Gene Tiso_gene_12256 ==
* smiles:
+
* right end position:
** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** 7189
* inchi key:
+
* transcription direction:
** InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** (R)-3-hydroxyoctanoyl-CoA
+
** 3060
* molecular weight:
+
* centisome position:
** 905.7    
+
** 42.559113    
 
* Synonym(s):
 
* Synonym(s):
** (R)-3-hydroxyoctanoyl-CoA
 
** (3R)-3-hydroxyoctanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14275]]
+
* Reaction: [[ADENYL-KIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
* [[RXN-14276]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=7189}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173319 46173319]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=3060}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74279 74279]
+
{{#set: centisome position=42.559113   }}
* BIGG : 3hocoa
+
{{#set: reaction associated=ADENYL-KIN-RXN}}
{{#set: smiles=CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: pathway associated=PWY-7219}}
{{#set: inchi key=InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J}}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: molecular weight=905.7   }}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA|(3R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: consumed by=RXN-14275}}
+
{{#set: produced by=RXN-14276}}
+

Revision as of 15:46, 21 March 2018

Gene Tiso_gene_12256

  • right end position:
    • 7189
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3060
  • centisome position:
    • 42.559113
  • Synonym(s):

Reactions associated

Pathways associated

External links