Difference between revisions of "P181-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
 
* common name:
 
* common name:
** a dodecanoyl-[acp]
+
** 5α-cholesta-8,24-dien-3-one
 +
* inchi key:
 +
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
** a dodecanoyl-[acyl-carrier protein]
 
** a lauryl-[acp]
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9535]]
 
* [[RXN-9653]]
 
* [[3.1.2.21-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9534]]
+
* [[RXN66-318]]
* [[RXN-9661]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a dodecanoyl-[acp]}}
+
* PUBCHEM:
{{#set: common name=a dodecanoyl-[acyl-carrier protein]|a lauryl-[acp]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
{{#set: consumed by=RXN-9535|RXN-9653|3.1.2.21-RXN}}
+
* CHEBI:
{{#set: produced by=RXN-9534|RXN-9661}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
 +
{{#set: common name=5α-cholesta-8,24-dien-3-one}}
 +
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: produced by=RXN66-318}}

Revision as of 14:46, 21 March 2018

Metabolite CPD-4581

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
  • common name:
    • 5α-cholesta-8,24-dien-3-one
  • inchi key:
    • InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
  • molecular weight:
    • 382.628
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.