Difference between revisions of "DNA-Ligase-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-L-arabin...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(O)CO
 
* common name:
 
* common name:
** chloroplast_beta-keto_acyl_reductase
+
** aldehydo-L-arabinose
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-14273]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-14277]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-14102]]
** 1 3-oxo-lignoceroyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 (3R)-3-hydroxy-lignoceroyl-CoA[c]
+
* [[RXN-14808]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_9871]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
** '''16''' reactions found over '''16''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
{{#set: ec number=EC-1.1.1.330}}
+
* CHEBI:
{{#set: gene associated=Tiso_gene_9871}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
{{#set: in pathway=PWY-7036}}
+
* LIGAND-CPD:
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=aldehydo-L-arabinose}}
 +
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: reversible reaction associated=RXN-14102|RXN-14808}}

Revision as of 14:47, 21 March 2018

Metabolite CPD-15699

  • smiles:
    • [CH](=O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-L-arabinose
  • inchi key:
    • InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
  • molecular weight:
    • 150.131
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.