Difference between revisions of "CPD-14404"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCO * inchi key: ** InChIKey=BOTWFXYS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12647 CPD-12647] == * smiles: ** CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12647 CPD-12647] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (11Z,14Z,17Z)-icosa-11,14,17-trienoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=BVBYYRVLCDMZNJ-SKYNJMBCSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1051.975 |
* Synonym(s): | * Synonym(s): | ||
| − | + | ** (11Z,14Z,17Z)-eicosatrienoyl-CoA | |
| − | ** ( | + | ** 20:3Δ11,14,17 |
| + | ** (11Z,14Z,17Z)-icosatrienoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16100]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12997]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859609 49859609] |
| − | + | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)}} | |
| − | + | {{#set: common name=(11Z,14Z,17Z)-icosa-11,14,17-trienoyl-CoA}} | |
| − | + | {{#set: inchi key=InChIKey=BVBYYRVLCDMZNJ-SKYNJMBCSA-J}} | |
| − | + | {{#set: molecular weight=1051.975 }} | |
| − | + | {{#set: common name=(11Z,14Z,17Z)-eicosatrienoyl-CoA|20:3Δ11,14,17|(11Z,14Z,17Z)-icosatrienoyl-CoA}} | |
| − | + | {{#set: consumed by=RXN-16100}} | |
| − | + | {{#set: produced by=RXN-12997}} | |
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
Revision as of 14:47, 21 March 2018
Contents
Metabolite CPD-12647
- smiles:
- CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)
- common name:
- (11Z,14Z,17Z)-icosa-11,14,17-trienoyl-CoA
- inchi key:
- InChIKey=BVBYYRVLCDMZNJ-SKYNJMBCSA-J
- molecular weight:
- 1051.975
- Synonym(s):
- (11Z,14Z,17Z)-eicosatrienoyl-CoA
- 20:3Δ11,14,17
- (11Z,14Z,17Z)-icosatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC=CCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)" cannot be used as a page name in this wiki.
