Difference between revisions of "Tiso gene 284"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.14.19.17 EC-1.14.19.17] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 2 [[PROTON]][c] '''+''' 1 [[CPD3DJ-82]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[N-Acylsphingosine]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 2 H+[c] '''+''' 1 a dihydroceramide[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''=>''' 1 a sphingosine ceramide[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY3DJ-12]], ceramide de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.19.17}} | |
− | {{#set: | + | {{#set: in pathway=PWY3DJ-12}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Revision as of 14:47, 21 March 2018
Contents
Reaction RXN-16332
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 PROTON[c] + 1 CPD3DJ-82[c] + 2 FERROCYTOCHROME-B5[c] + 1 OXYGEN-MOLECULE[c] => 1 N-Acylsphingosine[c] + 2 FERRICYTOCHROME-B5[c] + 2 WATER[c]
- With common name(s):
- 2 H+[c] + 1 a dihydroceramide[c] + 2 a ferrocytochrome b5[c] + 1 oxygen[c] => 1 a sphingosine ceramide[c] + 2 a ferricytochrome b5[c] + 2 H2O[c]
Genes associated with this reaction
Pathways
- PWY3DJ-12, ceramide de novo biosynthesis: PWY3DJ-12
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation