Difference between revisions of "RXN-13926"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-131567 TAX-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-131567 TAX-131567]
−
* inchi key:
+
−
** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
+
 
* common name:
 
* common name:
−
** 5α-cholestan-3-one
+
** sciadonate biosynthesis
−
* molecular weight:
+
−
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5,11,14-eicosatrienoic acid biosynthesis
 +
** 5,11,14-eicosatrienoate biosynthesis
 +
** sciadonic acid biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-16094]]
−
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16095]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9871]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16096]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16097]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11677 RXN-11677]
 
== External links  ==
 
== External links  ==
−
* CAS : 566-88-1
+
{{#set: taxonomic range=TAX-131567}}
−
* PUBCHEM:
+
{{#set: common name=sciadonate biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128]
+
{{#set: common name=5,11,14-eicosatrienoic acid biosynthesis|5,11,14-eicosatrienoate biosynthesis|sciadonic acid biosynthesis}}
−
* HMDB : HMDB00871
+
{{#set: reaction found=4}}
−
* LIGAND-CPD:
+
{{#set: total reaction=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238]
+
{{#set: completion rate=80.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.83174.html 83174]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762]
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}}
+
−
{{#set: common name=5α-cholestan-3-one}}
+
−
{{#set: molecular weight=386.66    }}
+
−
{{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}}
+

Revision as of 14:47, 21 March 2018

Pathway PWY-6598

  • taxonomic range:
  • common name:
    • sciadonate biosynthesis
  • Synonym(s):
    • 5,11,14-eicosatrienoic acid biosynthesis
    • 5,11,14-eicosatrienoate biosynthesis
    • sciadonic acid biosynthesis

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13926&oldid=30220"