Difference between revisions of "RXN-16332"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10743 == * left end position: ** 5264 * transcription direction: ** POSITIVE * right end position: ** 7952 * centisome position: ** 63.2008...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 5α-cholestan-3-one |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 386.66 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 566-88-1 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128] |
| − | {{#set: | + | * HMDB : HMDB00871 |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.83174.html 83174] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762] | ||
| + | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=5α-cholestan-3-one}} | ||
| + | {{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}} | ||
| + | {{#set: molecular weight=386.66 }} | ||
| + | {{#set: reversible reaction associated=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}} | ||
Revision as of 14:47, 21 March 2018
Contents
Metabolite CPD-1081
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 5α-cholestan-3-one
- inchi key:
- InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
- molecular weight:
- 386.66
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
