Difference between revisions of "RXN-2542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE D-XYLULOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972] ==
* smiles:
+
* taxonomic range:
** C(O)C(O)C(O)C(=O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=ZAQJHHRNXZUBTE-WUJLRWPWSA-N
+
 
* common name:
 
* common name:
** D-xylulose
+
** stearate biosynthesis I (animals and fungi)
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** xylulose
+
** stearic acid biosynthesis
** D-threo-pentulose
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[XYLULOKIN-RXN]]
+
'''4''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-9543]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_6671]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-9544]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8022]]
 +
*** [[Tiso_gene_13083]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9623]]
 +
** 10 associated gene(s):
 +
*** [[Tiso_gene_9394]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_12275]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_7855]]
 +
*** [[Tiso_gene_348]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_4191]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-9624]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_7477]]
 +
*** [[Tiso_gene_801]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9545 RXN-9545]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546]
 
== External links  ==
 
== External links  ==
* CAS : 551-84-8
+
{{#set: taxonomic range=TAX-33154}}
* METABOLIGHTS : MTBLC17140
+
{{#set: taxonomic range=TAX-2}}
* DRUGBANK : DB03947
+
{{#set: common name=stearate biosynthesis I (animals and fungi)}}
* PUBCHEM:
+
{{#set: common name=stearic acid biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289590 5289590]
+
{{#set: reaction found=4}}
* HMDB : HMDB01644
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=67.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00310 C00310]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4451524.html 4451524]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17140 17140]
+
* BIGG : xylu__D
+
{{#set: smiles=C(O)C(O)C(O)C(=O)CO}}
+
{{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-WUJLRWPWSA-N}}
+
{{#set: common name=D-xylulose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=xylulose|D-threo-pentulose}}
+
{{#set: consumed by=XYLULOKIN-RXN}}
+

Revision as of 14:48, 21 March 2018

Pathway PWY-5972

  • taxonomic range:
  • common name:
    • stearate biosynthesis I (animals and fungi)
  • Synonym(s):
    • stearic acid biosynthesis

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links