Difference between revisions of "Tiso gene 11386"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * common name...") |
||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) | ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** 5-hydroxyindole thiazolidine carboxylate | ** 5-hydroxyindole thiazolidine carboxylate | ||
| + | * inchi key: | ||
| + | ** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
** 278.325 | ** 278.325 | ||
| Line 22: | Line 22: | ||
** [http://www.chemspider.com/Chemical-Structure.169392.html 169392] | ** [http://www.chemspider.com/Chemical-Structure.169392.html 169392] | ||
{{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}} | {{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}} | ||
| − | |||
{{#set: common name=5-hydroxyindole thiazolidine carboxylate}} | {{#set: common name=5-hydroxyindole thiazolidine carboxylate}} | ||
| + | {{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}} | ||
{{#set: molecular weight=278.325 }} | {{#set: molecular weight=278.325 }} | ||
{{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}} | {{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}} | ||
{{#set: reversible reaction associated=RXN-10779}} | {{#set: reversible reaction associated=RXN-10779}} | ||
Revision as of 14:48, 21 March 2018
Contents
Metabolite CPD-11670
- smiles:
- C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
- common name:
- 5-hydroxyindole thiazolidine carboxylate
- inchi key:
- InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
- molecular weight:
- 278.325
- Synonym(s):
- 5-hydroxyindole thiazolidine carboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
