Difference between revisions of "Tiso gene 19542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7985 RXN-7985] == * direction: ** LEFT-TO-RIGHT * common name: ** violaxanthin de-epoxidase **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7985 RXN-7985] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 
* common name:
 
* common name:
−
** violaxanthin de-epoxidase
+
** gibberellin A15 (open lactone form)
−
** violaxanthin_de-_chloroplast
+
* inchi key:
−
** violaxanthin_de-epoxidase
+
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
 +
* molecular weight:
 +
** 346.422   
 
* Synonym(s):
 
* Synonym(s):
−
** VDE
+
** gibberellin A15
 +
** GA15
 +
** GA15 (open lactone form)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-163]]
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD1F-131]][c] '''+''' 1 [[ASCORBATE]][c] '''=>''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[CPD1F-130]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-162]]
−
** 1 H+[c] '''+''' 1 antheraxanthin[c] '''+''' 1 L-ascorbate[c] '''=>''' 1 L-dehydro-ascorbate[c] '''+''' 1 zeaxanthin[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5666]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_1275]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_16523]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIPID_MAPS : LMPR0104170017
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21800 21800]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
−
** [http://www.genome.jp/dbget-bin/www_bget?R07179 R07179]
+
* CHEBI:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
−
{{#set: common name=violaxanthin de-epoxidase}}
+
* LIGAND-CPD:
−
{{#set: common name=violaxanthin_de-_chloroplast}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
−
{{#set: common name=violaxanthin_de-epoxidase}}
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
−
{{#set: common name=VDE}}
+
{{#set: common name=gibberellin A15 (open lactone form)}}
−
{{#set: gene associated=Tiso_gene_5666|Tiso_gene_1275|Tiso_gene_16523}}
+
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
−
{{#set: in pathway=PWY-5945}}
+
{{#set: molecular weight=346.422    }}
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
{{#set: consumed by=RXN1F-163}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: produced by=RXN1F-162}}

Revision as of 14:48, 21 March 2018

Metabolite CPD1F-97

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A15 (open lactone form)
  • inchi key:
    • InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
  • molecular weight:
    • 346.422
  • Synonym(s):
    • gibberellin A15
    • GA15
    • GA15 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19542&oldid=30369"