Difference between revisions of "Tiso gene 6578"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_MG+2 ExchangeSeed_MG+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
+ | * common name: | ||
+ | ** (3R)-hydroxy-tetracosatetraenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=DMYSJGJJPTXMAW-JJKILJMSSA-J | ||
+ | * molecular weight: | ||
+ | ** 1122.065 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA | ||
+ | ** (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17109]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193803 72193803] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76417 76417] |
− | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
+ | {{#set: common name=(3R)-hydroxy-tetracosatetraenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=DMYSJGJJPTXMAW-JJKILJMSSA-J}} | ||
+ | {{#set: molecular weight=1122.065 }} | ||
+ | {{#set: common name=(3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA|(3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-17109}} |
Revision as of 15:48, 21 March 2018
Contents
Metabolite CPD-18489
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (3R)-hydroxy-tetracosatetraenoyl-CoA
- inchi key:
- InChIKey=DMYSJGJJPTXMAW-JJKILJMSSA-J
- molecular weight:
- 1122.065
- Synonym(s):
- (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
- (3R)-hydroxy-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.