Difference between revisions of "PWY-1801"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=7KAPSYN-RXN 7KAPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=7KAPSYN-RXN 7KAPSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.3.1.47 EC-2.3.1.47]
+
** ent-kaurenol
 +
* inchi key:
 +
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
 +
* molecular weight:
 +
** 288.472   
 
* Synonym(s):
 
* Synonym(s):
 +
** ent-kaur-16-en-19-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5242]]
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD-558]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''=>''' 1 [[8-AMINO-7-OXONONANOATE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[1.14.13.78-RXN]]
−
** 1 H+[c] '''+''' 1 pimeloyl-CoA[c] '''+''' 1 L-alanine[c] '''=>''' 1 8-amino-7-oxononanoate[c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3555]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6578]], 8-amino-7-oxononanoate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20712 20712]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
−
* LIGAND-RXN:
+
* HMDB : HMDB36727
−
** [http://www.genome.jp/dbget-bin/www_bget?R03210 R03210]
+
* CHEBI:
−
* UNIPROT:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
−
** [http://www.uniprot.org/uniprot/Q58694 Q58694]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/O84782 O84782]
+
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
−
** [http://www.uniprot.org/uniprot/Q9Z6Y3 Q9Z6Y3]
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
−
** [http://www.uniprot.org/uniprot/P0A4X4 P0A4X4]
+
{{#set: common name=ent-kaurenol}}
−
** [http://www.uniprot.org/uniprot/Q9K0U0 Q9K0U0]
+
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
−
** [http://www.uniprot.org/uniprot/Q9PLE6 Q9PLE6]
+
{{#set: molecular weight=288.472    }}
−
** [http://www.uniprot.org/uniprot/P44422 P44422]
+
{{#set: common name=ent-kaur-16-en-19-ol}}
−
** [http://www.uniprot.org/uniprot/O25320 O25320]
+
{{#set: consumed by=RXN-5242}}
−
** [http://www.uniprot.org/uniprot/P53556 P53556]
+
{{#set: produced by=1.14.13.78-RXN}}
−
** [http://www.uniprot.org/uniprot/Q9PIJ3 Q9PIJ3]
+
−
** [http://www.uniprot.org/uniprot/O66875 O66875]
+
−
** [http://www.uniprot.org/uniprot/Q9ZLN3 Q9ZLN3]
+
−
** [http://www.uniprot.org/uniprot/Q9Z6L6 Q9Z6L6]
+
−
** [http://www.uniprot.org/uniprot/Q9JT28 Q9JT28]
+
−
** [http://www.uniprot.org/uniprot/P22806 P22806]
+
−
** [http://www.uniprot.org/uniprot/P45487 P45487]
+
−
** [http://www.uniprot.org/uniprot/P74770 P74770]
+
−
** [http://www.uniprot.org/uniprot/P12998 P12998]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-2.3.1.47}}
+
−
{{#set: gene associated=Tiso_gene_3555}}
+
−
{{#set: in pathway=PWY-6578}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 14:48, 21 March 2018

Metabolite ENT-KAUR-16-EN-19-OL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
  • common name:
    • ent-kaurenol
  • inchi key:
    • InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
  • molecular weight:
    • 288.472
  • Synonym(s):
    • ent-kaur-16-en-19-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-1801&oldid=30386"