Difference between revisions of "Tiso gene 11849"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXO-EICOSAPENTAENOYL-ACP 3-OXO-EICOSAPENTAENOYL-ACP] == * common name: ** a 3-oxo-docosapenta...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == |
+ | * smiles: | ||
+ | ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-])) | ||
* common name: | * common name: | ||
− | ** a | + | ** cob(I)yrinate a,c-diamide |
+ | * inchi key: | ||
+ | ** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H | ||
+ | * molecular weight: | ||
+ | ** 931.9 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** a | + | ** cob(I)yrinic acid a,c-diamide |
+ | ** Cob(I)yrinate diamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[R344-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name=a | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689] |
− | {{#set: consumed by= | + | * HMDB : HMDB06904 |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505] | ||
+ | {{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}} | ||
+ | {{#set: common name=cob(I)yrinate a,c-diamide}} | ||
+ | {{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}} | ||
+ | {{#set: molecular weight=931.9 }} | ||
+ | {{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}} | ||
+ | {{#set: consumed by=R344-RXN}} |
Revision as of 15:48, 21 March 2018
Contents
Metabolite CPD-694
- smiles:
- CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
- common name:
- cob(I)yrinate a,c-diamide
- inchi key:
- InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
- molecular weight:
- 931.9
- Synonym(s):
- cob(I)yrinic acid a,c-diamide
- Cob(I)yrinate diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))" cannot be used as a page name in this wiki.