Difference between revisions of "UDPGLUCEPIM-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == |
− | * | + | * smiles: |
− | ** [ | + | ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O) |
* common name: | * common name: | ||
− | ** | + | ** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L | ||
+ | * molecular weight: | ||
+ | ** 285.193 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** C1-(3-Indolyl)-glycerol 3-phosphate |
+ | ** indole-3-glycerol-P | ||
+ | ** 1-(indol-3-yl)glycerol-3-P | ||
+ | ** 1-(indol-3-yl)glycerol-3-phosphate | ||
+ | ** indoleglycerol phosphate | ||
+ | ** indole-3-glycerol-phosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[TRYPSYN-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[IGPSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-2381]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866] |
− | {{#set: | + | * BIGG : 3ig3p |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506] | ||
+ | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}} | ||
+ | {{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}} | ||
+ | {{#set: molecular weight=285.193 }} | ||
+ | {{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}} | ||
+ | {{#set: consumed by=TRYPSYN-RXN}} | ||
+ | {{#set: produced by=IGPSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN0-2381}} |
Revision as of 14:49, 21 March 2018
Contents
Metabolite INDOLE-3-GLYCEROL-P
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
- common name:
- (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
- inchi key:
- InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
- molecular weight:
- 285.193
- Synonym(s):
- C1-(3-Indolyl)-glycerol 3-phosphate
- indole-3-glycerol-P
- 1-(indol-3-yl)glycerol-3-P
- 1-(indol-3-yl)glycerol-3-phosphate
- indoleglycerol phosphate
- indole-3-glycerol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.