Difference between revisions of "UDPGLUCEPIM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
 
* common name:
 
* common name:
** creatinine degradation I
+
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
 +
* inchi key:
 +
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
 +
* molecular weight:
 +
** 285.193   
 
* Synonym(s):
 
* Synonym(s):
** creatinine catabolism
+
** C1-(3-Indolyl)-glycerol 3-phosphate
 +
** indole-3-glycerol-P
 +
** 1-(indol-3-yl)glycerol-3-P
 +
** 1-(indol-3-yl)glycerol-3-phosphate
 +
** indoleglycerol phosphate
 +
** indole-3-glycerol-phosphate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''4''' reactions in the full pathway
+
* [[TRYPSYN-RXN]]
* [[CREATINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
* [[IGPSYN-RXN]]
*** [[Tiso_gene_14456]]
+
== Reaction(s) of unknown directionality ==
** 1 reconstruction source(s) associated:
+
* [[RXN0-2381]]
*** [[orthology-esiliculosus]]
+
* [[SARCOSINE-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_14788]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=CREATININASE-RXN CREATININASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=SARCOX-RXN SARCOX-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=creatinine degradation I}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
{{#set: common name=creatinine catabolism}}
+
* CHEBI:
{{#set: reaction found=2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
{{#set: total reaction=4}}
+
* BIGG : 3ig3p
{{#set: completion rate=50.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
 +
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
 +
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
 +
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
 +
{{#set: molecular weight=285.193    }}
 +
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
 +
{{#set: consumed by=TRYPSYN-RXN}}
 +
{{#set: produced by=IGPSYN-RXN}}
 +
{{#set: reversible reaction associated=RXN0-2381}}

Revision as of 14:49, 21 March 2018

Metabolite INDOLE-3-GLYCEROL-P

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
  • common name:
    • (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
  • inchi key:
    • InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
  • molecular weight:
    • 285.193
  • Synonym(s):
    • C1-(3-Indolyl)-glycerol 3-phosphate
    • indole-3-glycerol-P
    • 1-(indol-3-yl)glycerol-3-P
    • 1-(indol-3-yl)glycerol-3-phosphate
    • indoleglycerol phosphate
    • indole-3-glycerol-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.