Difference between revisions of "Tiso gene 4645"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_8159 == * right end position: ** 11781 * transcription direction: ** NEGATIVE * left end position: ** 3776 * centisome position: ** 29.9896...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8159 == |
− | * | + | * right end position: |
− | ** | + | ** 11781 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3776 |
− | * | + | * centisome position: |
− | ** | + | ** 29.989676 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ACID-PHOSPHATASE-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-5822]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6348]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=11781}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3776}} | |
− | + | {{#set: centisome position=29.989676 }} | |
− | + | {{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXN-5822}} | |
− | + | {{#set: pathway associated=PWY-6348|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:49, 21 March 2018
Gene Tiso_gene_8159
- right end position:
- 11781
- transcription direction:
- NEGATIVE
- left end position:
- 3776
- centisome position:
- 29.989676
- Synonym(s):
Reactions associated
- Reaction: ACID-PHOSPHATASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-5822
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation