Difference between revisions of "Tiso gene 15422"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_2247 == * Synonym(s): == Reactions associated == * Reaction: RXN0-1461 ** Source: annotation-in-silico_annotation *** Assignment:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2247 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-1461]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | + | ** Source: [[orthology-athaliana]] | |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY0-1415]] |
+ | * [[HEME-BIOSYNTHESIS-II]] | ||
+ | * [[CHLOROPHYLL-SYN]] | ||
+ | * [[PWY-7159]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN0-1461}} | |
− | + | {{#set: pathway associated=PWY0-1415|HEME-BIOSYNTHESIS-II|CHLOROPHYLL-SYN|PWY-7159}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 14:49, 21 March 2018
Gene Tiso_gene_2247
- Synonym(s):
Reactions associated
- Reaction: RXN0-1461
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation