Difference between revisions of "3.6.4.1-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-Serine N-terminal-N-Ac-L-Serine] == * common name: ** an N-terminal Nα-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-Serine N-terminal-N-Ac-L-Serine] ==
−
* smiles:
+
−
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
−
* inchi key:
+
−
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
−
** FAD
+
** an N-terminal Nα-acetyl-L-seryl-[protein]
−
* molecular weight:
+
−
** 782.533   
+
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide oxidized
+
** a [protein] N-terminal Nα-acetyl-L-serine
−
** flavin adenine dinucleotide
+
−
** flavitan
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[MEPROPCOA-FAD-RXN]]
 
−
* [[ACOA120or]]
 
−
* [[MCDH_2mb2coa]]
 
−
* [[ACOA140or]]
 
−
* [[ACOA160or]]
 
−
* [[ACOA80or]]
 
−
* [[MCDH]]
 
−
* [[IVCDH]]
 
−
* [[ACOA40or]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[G3PD3]]
+
* [[RXN-17863]]
−
* [[FADSYN-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PPCOAOm]]
 
−
* [[RXN-14264]]
 
−
* [[RXN-14193]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 146-14-5
+
{{#set: common name=an N-terminal Nα-acetyl-L-seryl-[protein]}}
−
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: common name=a [protein] N-terminal Nα-acetyl-L-serine}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-17863}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
−
* HMDB : HMDB01248
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
−
* BIGG : fad
+
−
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
−
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
−
{{#set: common name=FAD}}
+
−
{{#set: molecular weight=782.533    }}
+
−
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
−
{{#set: consumed by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}}
+
−
{{#set: produced by=G3PD3|FADSYN-RXN}}
+
−
{{#set: reversible reaction associated=PPCOAOm|RXN-14264|RXN-14193}}
+

Revision as of 14:50, 21 March 2018

Metabolite N-terminal-N-Ac-L-Serine

  • common name:
    • an N-terminal Nα-acetyl-L-seryl-[protein]
  • Synonym(s):
    • a [protein] N-terminal Nα-acetyl-L-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-seryl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal Nα-acetyl-L-serine" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.6.4.1-RXN&oldid=30589"