Difference between revisions of "Tiso gene 3732"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9600 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == |
+ | * smiles: | ||
+ | ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45)))) | ||
+ | * common name: | ||
+ | ** 26,27-dehydrozymosterol | ||
+ | * inchi key: | ||
+ | ** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N | ||
+ | * molecular weight: | ||
+ | ** 382.628 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11201]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155] | ||
+ | {{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}} | ||
+ | {{#set: common name=26,27-dehydrozymosterol}} | ||
+ | {{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}} | ||
+ | {{#set: molecular weight=382.628 }} | ||
+ | {{#set: consumed by=RXN-11201}} |
Revision as of 14:50, 21 March 2018
Contents
Metabolite CPD-12159
- smiles:
- CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
- common name:
- 26,27-dehydrozymosterol
- inchi key:
- InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
- molecular weight:
- 382.628
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))" cannot be used as a page name in this wiki.