Difference between revisions of "RXN0-5468"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.52-RXN 3.5.1.52-RXN] == * direction: ** REVERSIBLE * common name: ** peptide-n4-(n-acetyl-bet...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.52-RXN 3.5.1.52-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** peptide-n4-(n-acetyl-beta-glucosaminyl)asparagine_amidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.1.52 EC-3.5.1.52] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-8541]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Protein-L-Aspartates]][c] '''+''' 1 [[N-ACETYL-BETA-GLUCOSAMINYLAMINE]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 H2O[c] '''+''' 1 a [protein]-N4-(N-acetyl-β-D-glucosaminyl)-L-asparagine[c] '''<=>''' 1 H+[c] '''+''' 1 a [protein]-L-aspartate[c] '''+''' 1 N-acetyl-β-glucosaminylamine[c] | |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_18090]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_18091]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | == Pathways == |
− | * [[ | + | == Reconstruction information == |
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/P81898 P81898] | |
− | + | ** [http://www.uniprot.org/uniprot/P21163 P21163] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=peptide-n4-(n-acetyl-beta-glucosaminyl)asparagine_amidase}} | |
− | + | {{#set: ec number=EC-3.5.1.52}} | |
− | ** [http://www. | + | {{#set: gene associated=Tiso_gene_18090|Tiso_gene_18091}} |
− | + | {{#set: in pathway=}} | |
− | ** [http://www. | + | {{#set: reconstruction category=annotation}} |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:51, 21 March 2018
Contents
Reaction 3.5.1.52-RXN
- direction:
- REVERSIBLE
- common name:
- peptide-n4-(n-acetyl-beta-glucosaminyl)asparagine_amidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-8541[c] <=> 1 PROTON[c] + 1 Protein-L-Aspartates[c] + 1 N-ACETYL-BETA-GLUCOSAMINYLAMINE[c]
- With common name(s):
- 1 H2O[c] + 1 a [protein]-N4-(N-acetyl-β-D-glucosaminyl)-L-asparagine[c] <=> 1 H+[c] + 1 a [protein]-L-aspartate[c] + 1 N-acetyl-β-glucosaminylamine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18090
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18091
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links