Difference between revisions of "2.7.8.24-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acp] reduc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] == * smiles: ** CC(C)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C)
 
* common name:
 
* common name:
−
** trans oct-2-enoyl-[acp] reductase
+
** phylloquinone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N
 +
* molecular weight:
 +
** 450.703   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-methyl-3-phytyl-1,4-naphthoquinone
 +
** phytonadione
 +
** phytomenadione
 +
** 3-phytylmenadione
 +
** vitamin K1
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-Octenoyl-ACPs]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
* [[R06859]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans oct-2-enoyl-[acp][c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 NAD+[c]
+
* [[1.1.4.1-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans oct-2-enoyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280483 5280483]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CAS : 84-80-0
−
{{#set: gene associated=Tiso_gene_10778}}
+
* Wikipedia : Phylloquinone
−
{{#set: in pathway=PWY-5971}}
+
* NCI:
−
{{#set: reconstruction category=orthology}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=270681 270681]
−
{{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}}
+
* HMDB : HMDB03555
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02059 C02059]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4444124.html 4444124]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=583972 583972]
 +
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C)}}
 +
{{#set: common name=phylloquinone}}
 +
{{#set: inchi key=InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N}}
 +
{{#set: molecular weight=450.703    }}
 +
{{#set: common name=2-methyl-3-phytyl-1,4-naphthoquinone|phytonadione|phytomenadione|3-phytylmenadione|vitamin K1}}
 +
{{#set: produced by=R06859}}
 +
{{#set: reversible reaction associated=1.1.4.1-RXN}}

Revision as of 14:52, 21 March 2018

Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C)
  • common name:
    • phylloquinone
  • inchi key:
    • InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N
  • molecular weight:
    • 450.703
  • Synonym(s):
    • 2-methyl-3-phytyl-1,4-naphthoquinone
    • phytonadione
    • phytomenadione
    • 3-phytylmenadione
    • vitamin K1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.7.8.24-RXN&oldid=30820"