Difference between revisions of "PWY-7659"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acp] reduc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans oct-2-enoyl-[acp] reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[NAD]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 a trans oct-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 NAD+[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_10778]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
| + | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=trans oct-2-enoyl-[acp] reductase}} | |
| − | + | {{#set: ec number=EC-1.3.1.9}} | |
| − | + | {{#set: gene associated=Tiso_gene_10778}} | |
| − | + | {{#set: in pathway=PWY-5971}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:52, 21 March 2018
Contents
Reaction RXN-9659
- direction:
- LEFT-TO-RIGHT
- common name:
- trans oct-2-enoyl-[acp] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-Octenoyl-ACPs[c] + 1 NADH[c] + 1 PROTON[c] => 1 Octanoyl-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 a trans oct-2-enoyl-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 an octanoyl-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10778
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-synechocystis
External links
"trans oct-2-enoyl-[acp] reductase" cannot be used as a page name in this wiki.
