Difference between revisions of "HPPD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * common name: ** maleamate * inchi k...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == |
* smiles: | * smiles: | ||
− | ** C(=O) | + | ** C(=CC(=O)[O-])C(N)=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** maleamate |
+ | * inchi key: | ||
+ | ** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 114.08 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** maleic acid monoamide |
− | ** | + | ** maleamic acid |
− | + | ** (Z)-4-amino-4-oxo-but-2-enoate | |
− | + | ||
− | + | ||
− | ** ( | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-646]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 557-24-4 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(=O) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596] |
− | {{#set: | + | {{#set: smiles=C(=CC(=O)[O-])C(N)=O}} |
− | {{#set: | + | {{#set: common name=maleamate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=114.08 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}} |
+ | {{#set: consumed by=RXN-646}} |
Revision as of 15:52, 21 March 2018
Contents
Metabolite MALEAMATE
- smiles:
- C(=CC(=O)[O-])C(N)=O
- common name:
- maleamate
- inchi key:
- InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
- molecular weight:
- 114.08
- Synonym(s):
- maleic acid monoamide
- maleamic acid
- (Z)-4-amino-4-oxo-but-2-enoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(N)=O" cannot be used as a page name in this wiki.