Difference between revisions of "Tiso gene 15682"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MN+2 MN+2] == * smiles: ** [Mn++] * common name: ** Mn2+ * inchi key: ** InChIKey=WAEMQWOKJMHJL...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MN+2 MN+2] == |
* smiles: | * smiles: | ||
− | ** | + | ** [Mn++] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Mn2+ |
+ | * inchi key: | ||
+ | ** InChIKey=WAEMQWOKJMHJLA-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 54.938 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** manganese ion |
+ | ** Mn(II) | ||
+ | ** Mn+2 | ||
+ | ** Mn++ | ||
+ | ** manganese (II) ion | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[TransportSeed_MN+2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[TransportSeed_MN+2]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ExchangeSeed_MN+2]] | ||
== External links == | == External links == | ||
+ | * CAS : 7439-96-5 | ||
+ | * CAS : 16397-91-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27854 27854] |
− | {{#set: smiles= | + | * HMDB : HMDB01333 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19610 C19610] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.25916.html 25916] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29035 29035] | ||
+ | * BIGG : mn2 | ||
+ | {{#set: smiles=[Mn++]}} | ||
+ | {{#set: common name=Mn2+}} | ||
+ | {{#set: inchi key=InChIKey=WAEMQWOKJMHJLA-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=54.938 }} | ||
+ | {{#set: common name=manganese ion|Mn(II)|Mn+2|Mn++|manganese (II) ion}} | ||
+ | {{#set: consumed by=TransportSeed_MN+2}} | ||
+ | {{#set: produced by=TransportSeed_MN+2}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_MN+2}} |
Revision as of 14:52, 21 March 2018
Contents
Metabolite MN+2
- smiles:
- [Mn++]
- common name:
- Mn2+
- inchi key:
- InChIKey=WAEMQWOKJMHJLA-UHFFFAOYSA-N
- molecular weight:
- 54.938
- Synonym(s):
- manganese ion
- Mn(II)
- Mn+2
- Mn++
- manganese (II) ion
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7439-96-5
- CAS : 16397-91-4
- PUBCHEM:
- HMDB : HMDB01333
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : mn2