Difference between revisions of "SSNOm"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] == * direction: ** REVERSIBLE * common name: ** polyketide_synthase ** ORF * e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * common name: ** trans-cinnamate...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C=CC1(=CC=CC=C1) |
* common name: | * common name: | ||
− | ** | + | ** trans-cinnamate |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M |
− | ** | + | * molecular weight: |
+ | ** 147.153 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β-phenylacrylic acid | ||
+ | ** 3-phenyl-2-propenoic acid | ||
+ | ** cinnamic acid | ||
+ | ** cinnamate | ||
+ | ** trans-cinnamic acid | ||
+ | ** (E)-cinnamate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-2001]] | |
− | + | * [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 140-10-3 |
− | ** [http:// | + | * BIGG : cinnm |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5957728 5957728] |
− | + | * HMDB : HMDB00930 | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00423 C00423] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4762929.html 4762929] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15669 15669] |
− | {{#set: | + | * METABOLIGHTS : MTBLC15669 |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C=CC1(=CC=CC=C1)}} |
+ | {{#set: common name=trans-cinnamate}} | ||
+ | {{#set: inchi key=InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M}} | ||
+ | {{#set: molecular weight=147.153 }} | ||
+ | {{#set: common name=β-phenylacrylic acid|3-phenyl-2-propenoic acid|cinnamic acid|cinnamate|trans-cinnamic acid|(E)-cinnamate}} | ||
+ | {{#set: consumed by=RXN-2001|TRANS-CINNAMATE-4-MONOOXYGENASE-RXN}} |
Revision as of 14:52, 21 March 2018
Contents
Metabolite CPD-674
- smiles:
- C(=O)([O-])C=CC1(=CC=CC=C1)
- common name:
- trans-cinnamate
- inchi key:
- InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M
- molecular weight:
- 147.153
- Synonym(s):
- β-phenylacrylic acid
- 3-phenyl-2-propenoic acid
- cinnamic acid
- cinnamate
- trans-cinnamic acid
- (E)-cinnamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 140-10-3
- BIGG : cinnm
- PUBCHEM:
- HMDB : HMDB00930
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15669
"C(=O)([O-])C=CC1(=CC=CC=C1)" cannot be used as a page name in this wiki.