Difference between revisions of "MGLDLCTANA-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17024 RXN-17024] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17024 RXN-17024] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** 1-acylglycerol-3-phosphate_o-acyltransferase
+
** cathasterone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
 +
* molecular weight:
 +
** 432.685   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-716]]
−
** 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[1-PALMITOYLGLYCEROL-3-PHOSPHATE]][c] '''=>''' 1 [[CPD-18390]][c] '''+''' 1 [[ACP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-715]]
−
** 1 a myristoyl-[acp][c] '''+''' 1 1-palmitoylglycerol 3-phosphate[c] '''=>''' 1 1-palmitoyl-2-myristoyl phosphatidate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13959]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
−
{{#set: ec number=EC-2.3.1.51}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_13959}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=cathasterone}}
 +
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
 +
{{#set: molecular weight=432.685    }}
 +
{{#set: consumed by=RXN-716}}
 +
{{#set: produced by=RXN-715}}

Revision as of 14:53, 21 March 2018

Metabolite CPD-714

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • cathasterone
  • inchi key:
    • InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
  • molecular weight:
    • 432.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MGLDLCTANA-PWY&oldid=31018"