Difference between revisions of "Cis-delta5-3-hydroxylignoceroyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Gene == Gene Tiso_gene_13087 == * right end position: ** 6476 * transcription direction: ** NEGATIVE * left end position: ** 1543 * centisome position: ** 23.5968...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Gene Tiso_gene_13087 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 6476
−
* common name:
+
* transcription direction:
−
** chlorophyllide b
+
** NEGATIVE
−
* molecular weight:
+
* left end position:
−
** 626.95    
+
** 1543
 +
* centisome position:
 +
** 23.59688    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7674]]
+
* Reaction: [[BETA-GLUCURONID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7677]]
+
*** Assignment: automated-name-match
−
* [[RXN-13398]]
+
* Reaction: [[RXN-15289]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7673]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15291]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7445]]
 +
* [[PWY-7247]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6476}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=1543}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: centisome position=23.59688    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=BETA-GLUCURONID-RXN|RXN-15289|RXN-15291}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: pathway associated=PWY-7445|PWY-7247}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyllide b}}
+
−
{{#set: molecular weight=626.95    }}
+
−
{{#set: consumed by=RXN-7674}}
+
−
{{#set: produced by=RXN-7677|RXN-13398}}
+
−
{{#set: reversible reaction associated=RXN-7673}}
+

Revision as of 14:54, 21 March 2018

Gene Tiso_gene_13087

  • right end position:
    • 6476
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1543
  • centisome position:
    • 23.59688
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta5-3-hydroxylignoceroyl-ACPs&oldid=31068"