Difference between revisions of "RXN-1404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] == * smiles: ** C([N+])C(=O)NC1(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-6 PWY4FS-6] ==
−
* smiles:
+
* taxonomic range:
−
** C([N+])C(=O)NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=OBQMLSFOUZUIOB-SHUUEZRQSA-M
+
 
* common name:
 
* common name:
−
** N1-(5-phospho-β-D-ribosyl)glycinamide
+
** phosphatidylethanolamine biosynthesis II
−
* molecular weight:
+
−
** 285.17   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-phospho-β-D-ribosyl-glycineamide
+
** Kennedy pathway
−
** 5'-phosphoribosylglycinamide
+
−
** 5'-phosphoribosylglycineamide
+
−
** 5'-p-ribosylglycinamide
+
−
** 5'-p-ribosylglycineamide
+
−
** GAR
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
* [[GLYRIBONUCSYN-RXN]]
+
* [[2.7.7.14-RXN]]
−
* [[FGFTm]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18070]]
−
* [[GART-RXN]]
+
** 4 reconstruction source(s) associated:
−
* [[FPGFTm]]
+
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ETHANOLAMINE-KINASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13392]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-5641]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* BIGG : gar
+
{{#set: taxonomic range=TAX-2759}}
−
* PUBCHEM:
+
{{#set: common name=phosphatidylethanolamine biosynthesis II}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657462 90657462]
+
{{#set: common name=Kennedy pathway}}
−
* HMDB : HMDB02022
+
{{#set: reaction found=4}}
−
* LIGAND-CPD:
+
{{#set: total reaction=4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03838 C03838]
+
{{#set: completion rate=100.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58457 58457]
+
−
* METABOLIGHTS : MTBLC58457
+
−
{{#set: smiles=C([N+])C(=O)NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1)}}
+
−
{{#set: inchi key=InChIKey=OBQMLSFOUZUIOB-SHUUEZRQSA-M}}
+
−
{{#set: common name=N1-(5-phospho-β-D-ribosyl)glycinamide}}
+
−
{{#set: molecular weight=285.17    }}
+
−
{{#set: common name=5-phospho-β-D-ribosyl-glycineamide|5'-phosphoribosylglycinamide|5'-phosphoribosylglycineamide|5'-p-ribosylglycinamide|5'-p-ribosylglycineamide|GAR}}
+
−
{{#set: produced by=GLYRIBONUCSYN-RXN|FGFTm}}
+
−
{{#set: reversible reaction associated=GART-RXN|FPGFTm}}
+

Revision as of 14:54, 21 March 2018

Pathway PWY4FS-6

  • taxonomic range:
  • common name:
    • phosphatidylethanolamine biosynthesis II
  • Synonym(s):
    • Kennedy pathway

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-1404&oldid=31130"