Difference between revisions of "RXN-9615"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR GDR] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide reductase * Synon...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR GDR] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
** glutathione-disulfide reductase
* molecular weight:
+
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-14:1-Δ7-CoA
 
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17794]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1.0 [[NADH]][c] '''=>''' 2.0 [[GLUTATHIONE]][c] '''+''' 1.0 [[NAD]][c]
* [[RXN-17793]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 H+[c] '''+''' 1.0 glutathione disulfide[c] '''+''' 1.0 NADH[c] '''=>''' 2.0 glutathione[c] '''+''' 1.0 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12533]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_2804]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
{{#set: common name=glutathione-disulfide reductase}}
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_12533|Tiso_gene_2804}}
{{#set: molecular weight=987.845    }}
+
{{#set: in pathway=}}
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN-17794}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: produced by=RXN-17793}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 15:55, 21 March 2018

Reaction GDR

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glutathione-disulfide reductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[c] + 1.0 glutathione disulfide[c] + 1.0 NADH[c] => 2.0 glutathione[c] + 1.0 NAD+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links