Difference between revisions of "PWY-7312"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5108 PWY-5108] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5108 PWY-5108] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-224756]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925]
 
* common name:
 
* common name:
** 7-dehydrodesmosterol
+
** L-isoleucine biosynthesis V
* molecular weight:
+
** 382.628   
+
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholesta-5,7,24-trien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-27]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2KETO-3METHYLVALERATE-RXN]]
* [[RXN66-26]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3260]]
 +
*** [[Tiso_gene_18084]]
 +
*** [[Tiso_gene_11793]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14984]]
 +
*** [[Tiso_gene_18403]]
 +
*** [[Tiso_gene_17748]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7764 RXN-7764]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-224756}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: taxonomic range=TAX-183925}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
+
{{#set: common name=L-isoleucine biosynthesis V}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
+
{{#set: total reaction=3}}
* HMDB : HMDB03896
+
{{#set: completion rate=67.0}}
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
+
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
+
{{#set: common name=7-dehydrodesmosterol}}
+
{{#set: molecular weight=382.628    }}
+
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
+
{{#set: consumed by=RXN66-27}}
+
{{#set: produced by=RXN66-26}}
+

Revision as of 14:55, 21 March 2018

Pathway PWY-5108

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links