Difference between revisions of "PWY-5871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-hydroxy-fatty-acids Lipid-hydroxy-fatty-acids] == * common name: ** a hydroxy-fatty-acyl-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-hydroxy-fatty-acids Lipid-hydroxy-fatty-acids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
 +
* smiles:
 +
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
 
* common name:
 
* common name:
** a hydroxy-fatty-acyl-[lipid]
+
** quinoxaline-2-carboxyl adenylate
 +
* inchi key:
 +
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
 +
* molecular weight:
 +
** 502.359   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.12-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a hydroxy-fatty-acyl-[lipid]}}
+
* PUBCHEM:
{{#set: produced by=1.11.1.12-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
 +
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
 +
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
 +
{{#set: molecular weight=502.359    }}
 +
{{#set: consumed by=RXN-17155}}

Revision as of 14:56, 21 March 2018

Metabolite CPD-18550

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
  • common name:
    • quinoxaline-2-carboxyl adenylate
  • inchi key:
    • InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
  • molecular weight:
    • 502.359
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.