Difference between revisions of "Tiso gene 17306"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.12-RXN 1.8.4.12-RXN] == * direction: ** REVERSIBLE * common name: ** peptide_methionine-r-sul...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.12-RXN 1.8.4.12-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** peptide_methionine-r-sulfoxide_reductase |
− | * | + | ** ORF |
− | ** | + | ** methionine_sulfoxide_reductase_with_associated_domain |
+ | ** methionine_sulfoxide_reductase_b | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.8.4.12 EC-1.8.4.12] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Protein-L-methionine]][c] '''<=>''' 1 [[Red-Thioredoxin]][c] '''+''' 1 [[Protein-L-methionine-R-S-oxides]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 an oxidized thioredoxin[c] '''+''' 1 H2O[c] '''+''' 1 a [protein]-L-methionine[c] '''<=>''' 1 a reduced thioredoxin[c] '''+''' 1 a protein-L-methionine-(R)-S-oxide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18058]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_19578]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_16975]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14455]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_6049]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24164 24164] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07607 R07607] | |
− | ** [http:// | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: common name=peptide_methionine-r-sulfoxide_reductase}} | |
− | * LIGAND- | + | {{#set: common name=ORF}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=methionine_sulfoxide_reductase_with_associated_domain}} |
− | + | {{#set: common name=methionine_sulfoxide_reductase_b}} | |
− | + | {{#set: ec number=EC-1.8.4.12}} | |
− | + | {{#set: gene associated=Tiso_gene_18058|Tiso_gene_19578|Tiso_gene_16975|Tiso_gene_14455|Tiso_gene_6049}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:56, 21 March 2018
Contents
Reaction 1.8.4.12-RXN
- direction:
- REVERSIBLE
- common name:
- peptide_methionine-r-sulfoxide_reductase
- ORF
- methionine_sulfoxide_reductase_with_associated_domain
- methionine_sulfoxide_reductase_b
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Ox-Thioredoxin[c] + 1 WATER[c] + 1 Protein-L-methionine[c] <=> 1 Red-Thioredoxin[c] + 1 Protein-L-methionine-R-S-oxides[c]
- With common name(s):
- 1 an oxidized thioredoxin[c] + 1 H2O[c] + 1 a [protein]-L-methionine[c] <=> 1 a reduced thioredoxin[c] + 1 a protein-L-methionine-(R)-S-oxide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18058
- Source: orthology-esiliculosus
- Gene: Tiso_gene_19578
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16975
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14455
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6049
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links