Difference between revisions of "1.2.1.27-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-151 RXN1F-151] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-151 RXN1F-151] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
** [http://enzyme.expasy.org/EC/5.5.1.19 EC-5.5.1.19]
−
* common name:
+
−
** 7-dehydrocholesterol
+
−
* molecular weight:
+
−
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-5,7-dien-3 β-ol
 
−
** cholesta-5,7-dienol
 
−
** 7-dehydro-cholesterol
 
−
** cholesta-5,7-dien-3β-ol
 
−
** provitamin D3
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-323]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD1F-126]][c] '''=>''' 1 [[CPD1F-129]][c]
−
* [[1.14.21.6-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 γ-carotene[c] '''=>''' 1 all-trans-β-carotene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4457]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_1547]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_3577]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11980]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_6282]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5943]], β-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5943 PWY-5943]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 434-16-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32242 32242]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03824 R03824]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-5.5.1.19}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
{{#set: gene associated=Tiso_gene_4457|Tiso_gene_1547|Tiso_gene_3577|Tiso_gene_11980|Tiso_gene_6282|Tiso_gene_8263}}
−
* HMDB : HMDB00032
+
{{#set: in pathway=PWY-5943}}
−
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}}
−
{{#set: common name=7-dehydrocholesterol}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
−
{{#set: consumed by=RXN66-323}}
+
−
{{#set: produced by=1.14.21.6-RXN}}
+

Revision as of 14:56, 21 March 2018

Reaction RXN1F-151

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 γ-carotene[c] => 1 all-trans-β-carotene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5943, β-carotene biosynthesis: PWY-5943
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.2.1.27-RXN&oldid=31309"