Difference between revisions of "PWY-881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phenylpropanoids methylation (ice plant) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''2''' reactions found over '''10''' reactions in the full pathway |
| − | == | + | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] |
| − | * [[ | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_10561]] | ||
| + | *** [[Tiso_gene_14561]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-1104]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_18971]] | ||
| + | *** [[Tiso_gene_18257]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.88-RXN 2.1.1.88-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13900 RXN-13900] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15534 RXN-15534] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15536 RXN-15536] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15537 RXN-15537] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8451 RXN-8451] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8452 RXN-8452] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=phenylpropanoids methylation (ice plant)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=10}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:56, 21 March 2018
Pathway PWY-7498
- taxonomic range:
- common name:
- phenylpropanoids methylation (ice plant)
- Synonym(s):
Reaction(s) found
2 reactions found over 10 reactions in the full pathway
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1104
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
