Difference between revisions of "PWY-6535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+2 CU+2] == * smiles: ** [Cu++] * inchi key: ** InChIKey=JPVYNHNXODAKFH-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * common name: ** thioguani...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** thioguanine |
| + | * inchi key: | ||
| + | ** InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 166.18 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 6-thioguanine |
| − | ** | + | ** 6-mercaptoguanine |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[TGUAt]] |
== External links == | == External links == | ||
| − | * | + | * DRUGBANK : DB00352 |
| − | ** [http:// | + | * LIGAND-CPD: |
| − | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07648 C07648] |
| − | + | * HMDB : HMDB14496 | |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9555 9555] |
| − | * | + | * PUBCHEM: |
| − | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203152 25203152] |
| − | {{#set: smiles=[ | + | {{#set: smiles=C1(N=C2(N=C(N)N=C([S-])C(N=1)2))}} |
| − | {{#set: | + | {{#set: common name=thioguanine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=166.18 }} |
| − | {{#set: common name= | + | {{#set: common name=6-thioguanine|6-mercaptoguanine}} |
| − | + | {{#set: reversible reaction associated=TGUAt}} | |
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Revision as of 14:56, 21 March 2018
Contents
Metabolite CPD-5721
- smiles:
- C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
- common name:
- thioguanine
- inchi key:
- InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
- molecular weight:
- 166.18
- Synonym(s):
- 6-thioguanine
- 6-mercaptoguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(N=C2(N=C(N)N=C([S-])C(N=1)2))" cannot be used as a page name in this wiki.
