Difference between revisions of "PWY-7274"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ENTNER-DOUDOROFF-PWY ENTNER-DOUDOROFF-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ENTNER-DOUDOROFF-PWY ENTNER-DOUDOROFF-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Entner-Doudoroff pathway I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ED pathway |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
− | * [[ | + | * [[KDPGALDOL-RXN]] |
− | * | + | ** 1 associated gene(s): |
− | + | *** [[Tiso_gene_12620]] | |
− | * | + | ** 1 reconstruction source(s) associated: |
− | * | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | == Reaction(s) not found == |
− | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=PGLUCONDEHYDRAT-RXN PGLUCONDEHYDRAT-RXN] |
− | * | + | |
− | * [[ | + | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ENTNER-DOUDOROFF-PWY ENTNER-DOUDOROFF-PWY] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=Entner-Doudoroff pathway I}} | |
− | + | {{#set: common name=ED pathway}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:57, 21 March 2018
Contents
Pathway ENTNER-DOUDOROFF-PWY
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- KDPGALDOL-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: