Difference between revisions of "Tiso gene 10793"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_18283 == * Synonym(s): == Reactions associated == * Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN ** Source: orthology-esiliculosus == Pa...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18283 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | * [[ | + | == Pathways associated == |
| − | == | + | |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 14:57, 21 March 2018
Gene Tiso_gene_18283
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: orthology-esiliculosus
