Difference between revisions of "RNA-3-PHOSPHATE-CYCLASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-Fatty-Acyl-CoA 2-Me-Branched-234-Sat-Fatty-Acyl-CoA] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == * smiles: ** C=C(C1(CC(C(CC1)(C)O)O))C * common name: ** (1S,2S,4R)-limon...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == |
+ | * smiles: | ||
+ | ** C=C(C1(CC(C(CC1)(C)O)O))C | ||
* common name: | * common name: | ||
− | ** | + | ** (1S,2S,4R)-limonene-1,2-diol |
+ | * inchi key: | ||
+ | ** InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N | ||
+ | * molecular weight: | ||
+ | ** 170.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (1R,2R,4S)-menth-8-ene-1,2-diol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.3.2.8-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-9464]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * UM-BBD-CPD : c0673 |
− | {{#set: produced by= | + | * LIPID_MAPS : LMPR0102090016 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441246 441246] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C07276 C07276] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.390019.html 390019] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18515 18515] | ||
+ | {{#set: smiles=C=C(C1(CC(C(CC1)(C)O)O))C}} | ||
+ | {{#set: common name=(1S,2S,4R)-limonene-1,2-diol}} | ||
+ | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N}} | ||
+ | {{#set: molecular weight=170.251 }} | ||
+ | {{#set: common name=(1R,2R,4S)-menth-8-ene-1,2-diol}} | ||
+ | {{#set: produced by=3.3.2.8-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-9464}} |
Revision as of 14:57, 21 March 2018
Contents
Metabolite CPD-8222
- smiles:
- C=C(C1(CC(C(CC1)(C)O)O))C
- common name:
- (1S,2S,4R)-limonene-1,2-diol
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N
- molecular weight:
- 170.251
- Synonym(s):
- (1R,2R,4S)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0673
- LIPID_MAPS : LMPR0102090016
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: